Products 2140306-07-4

CAS 2140306-07-4 is the registry number for Ethyl 3,3-dimethoxy-1-methylcyclobutane-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 3,3-dimethoxy-1-methylcyclobutane-1-carboxylate (CAS 2140306-07-4) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: ethyl 3,3-dimethoxy-1-methylcyclobutane-1-carboxylate. InChIKey: BAGRSSLMFIBWMI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O4
Molecular weight202.25 g/mol
IUPAC nameethyl 3,3-dimethoxy-1-methylcyclobutane-1-carboxylate
InChIKeyBAGRSSLMFIBWMI-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC(C1)(OC)OC)C

Computed by PubChem (NCBI)