CAS 18903-17-8 appears in our catalog under these names: Diethyl 2-methylthiazole-4,5-dicarboxylate, 95%, Diethyl 2-methylthiazole-4,5-dicarboxylate, 97%, 97%, 2-Methylthiazole-4,5-dicarboxylic acid diethylester, 96%, Diethyl 2-methylthiazole-4,5-dicarboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 10g.
Diethyl 2-methyl-1,3-thiazole-4,5-dicarboxylate (CAS 18903-17-8) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: diethyl 2-methyl-1,3-thiazole-4,5-dicarboxylate. InChIKey: AYIRUTZHPSMMAW-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | diethyl 2-methyl-1,3-thiazole-4,5-dicarboxylate |
| InChIKey | AYIRUTZHPSMMAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)C)C(=O)OCC |
Computed by PubChem (NCBI)