Products 695209-86-0
CAS 695209-86-0 appears in our catalog under these names: (3,4-Dimethyl-benzenesulfonylamino)-acetic acid, 95%, 2-(3,4-Dimethylbenzenesulfonamido)acetic acid, 95%, 2-(3,4-Dimethylbenzenesulfonamido)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-[(3,4-dimethylphenyl)sulfonylamino]acetic acid (CAS 695209-86-0) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 2-[(3,4-dimethylphenyl)sulfonylamino]acetic acid. InChIKey: WPAMAJNYVFMPDV-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 2-[(3,4-dimethylphenyl)sulfonylamino]acetic acid |
| InChIKey | WPAMAJNYVFMPDV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCC(=O)O)C |
Computed by PubChem (NCBI)