CAS 6270-57-1 appears in our catalog under these names: Diethyl 3,4–dihydroxyfuran–2,5–dicarboxylate, Diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate, 97% . Offered by: GLPBio, Thermo Scientific. Available pack sizes: 1g, 250mg.
Diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate (CAS 6270-57-1) is a chemical compound with the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. IUPAC name: diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate. InChIKey: JGCMPUKYPRCPRE-UHFFFAOYSA-N.
| Molecular formula | C10H12O7 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | diethyl 3,4-dihydroxyfuran-2,5-dicarboxylate |
| InChIKey | JGCMPUKYPRCPRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(O1)C(=O)OCC)O)O |
Computed by PubChem (NCBI)