cas: 1212211-21-6 — see every product listed under this CAS number, including other names
Diexo-3-(9-h-fluoren-9-ylmethoxycarbonylamino)-7-oxa-bicyclo(2.2.1)heptane-2-carboxylic acid, 95% (CAS 1212211-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1160155-1g |
| cas | 1212211-21-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 13272.28 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,2S,3R,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1212211-21-6) is a chemical compound with the molecular formula C22H21NO5 and a molecular weight of 379.4 g/mol. IUPAC name: (1R,2S,3R,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: ZDGWFBWXFWDVGM-WCIQWLHISA-N.
| Molecular formula | C22H21NO5 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | ZDGWFBWXFWDVGM-WCIQWLHISA-N |
| SMILES | C1C[C@H]2[C@@H]([C@@H]([C@@H]1O2)C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)