Products 208519-94-2

CAS 208519-94-2 is the registry number for (S)-1-((9H-Fluoren-9-yl)methyl) 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-O-ethyl 1-O-(9H-fluoren-9-ylmethyl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 208519-94-2) is a chemical compound with the molecular formula C22H21NO5 and a molecular weight of 379.4 g/mol. IUPAC name: 2-O-ethyl 1-O-(9H-fluoren-9-ylmethyl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: SPOXFTFFXPHVFI-IBGZPJMESA-N.

Identity
Molecular formulaC22H21NO5
Molecular weight379.4 g/mol
IUPAC name2-O-ethyl 1-O-(9H-fluoren-9-ylmethyl) (2S)-5-oxopyrrolidine-1,2-dicarboxylate
InChIKeySPOXFTFFXPHVFI-IBGZPJMESA-N
SMILESCCOC(=O)[C@@H]1CCC(=O)N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)