Products 63807-90-9
CAS 63807-90-9 appears in our catalog under these names: Dihydroalpinumisoflavone/ 98%, Dihydroalpinumisoflavone, Erythrivarone A. Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
5-hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-6-one (CAS 63807-90-9) is a chemical compound with the molecular formula C20H18O5 and a molecular weight of 338.4 g/mol. IUPAC name: 5-hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-6-one. InChIKey: BNPMTCOAGXAAIT-UHFFFAOYSA-N.
| Molecular formula | C20H18O5 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 5-hydroxy-7-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-6-one |
| InChIKey | BNPMTCOAGXAAIT-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=C3C(=C2O)C(=O)C(=CO3)C4=CC=C(C=C4)O)C |
Computed by PubChem (NCBI)