cas: 83541-68-8 — see every product listed under this CAS number, including other names
Diisopropyl (S)-2-hydroxysuccinate, 95% (CAS 83541-68-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F776256-5G |
| cas | 83541-68-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 25g | 1788.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Dipropan-2-yl (2S)-2-hydroxybutanedioate (CAS 83541-68-8) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: dipropan-2-yl (2S)-2-hydroxybutanedioate. InChIKey: XYVHRFVONMVDGK-QMMMGPOBSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | dipropan-2-yl (2S)-2-hydroxybutanedioate |
| InChIKey | XYVHRFVONMVDGK-QMMMGPOBSA-N |
| SMILES | CC(C)OC(=O)C[C@@H](C(=O)OC(C)C)O |
Computed by PubChem (NCBI)