cas: 115118-68-8 — see every product listed under this CAS number, including other names
Diisopropyl 3,3-Dimethoxycyclobutane-1,1-dicarboxylate, 97%, 97% (CAS 115118-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111GBN-1g |
| cas | 115118-68-8 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 174.80 Pln | |
| Chemat | 500g | 652.80 Pln | |
| Chemat | 1kg | 909.20 Pln | |
| Chemat | 5kg | 4526.40 Pln | |
| Chemat | 10kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dipropan-2-yl 3,3-dimethoxycyclobutane-1,1-dicarboxylate (CAS 115118-68-8) is a chemical compound with the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. IUPAC name: dipropan-2-yl 3,3-dimethoxycyclobutane-1,1-dicarboxylate. InChIKey: SZJMXTBKYMLPTJ-UHFFFAOYSA-N.
| Molecular formula | C14H24O6 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | dipropan-2-yl 3,3-dimethoxycyclobutane-1,1-dicarboxylate |
| InChIKey | SZJMXTBKYMLPTJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC(C1)(OC)OC)C(=O)OC(C)C |
Computed by PubChem (NCBI)