Products 2374216-86-9

CAS 2374216-86-9 is the registry number for Mono-5-carboxy-2-ethylpentyl Adipate. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

5-(5-carboxypentanoyloxymethyl)heptanoic acid (CAS 2374216-86-9) is a chemical compound with the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. IUPAC name: 5-(5-carboxypentanoyloxymethyl)heptanoic acid. InChIKey: GSEREAHHKPORII-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24O6
Molecular weight288.34 g/mol
IUPAC name5-(5-carboxypentanoyloxymethyl)heptanoic acid
InChIKeyGSEREAHHKPORII-UHFFFAOYSA-N
SMILESCCC(CCCC(=O)O)COC(=O)CCCCC(=O)O

Computed by PubChem (NCBI)