Diisopropyl oxalate, 95%
cas: 615-81-6 — see every product listed under this CAS number, including other names
Diisopropyl oxalate, 95% (CAS 615-81-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A440040-250mg |
| cas | 615-81-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1460.62 Pln | |
| Ambeed | 10g | 2506.38 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 1466.00 Pln | |
| Chemat | 10g | 2512.40 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 569.82 Pln | |
| BLDpharm | 5g | 1569.47 Pln | |
| BLDpharm | 10g | 2696.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Dipropan-2-yl oxalate (CAS 615-81-6) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: dipropan-2-yl oxalate. InChIKey: ITHNIFCFNUZYLQ-UHFFFAOYSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | dipropan-2-yl oxalate |
| InChIKey | ITHNIFCFNUZYLQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(=O)OC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Diisopropyl oxalate, Ethanedioic acid, bis(1-methylethyl) ester, InChI=1/C8H14O4/c1-5(2)11-7(9)8(10)12-6(3)4/h5-6H,1-4H, dipropan-2-yl oxalate, diisopropyloxalate, OXALIC ACID DIISOPROPYL ESTER, isopropyl oxalate, Di(propan-2-yl) ethanedioate, Ethanedioic acid, 1,2-bis(1-methylethyl) ester