Products 630-51-3
CAS 630-51-3 appears in our catalog under these names: 2,2,3,3-Tetramethylsuccinic acid, 95%, 2,2,3,3-Tetramethylsuccinic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 50mg, 250mg.
2,2,3,3-tetramethylbutanedioic acid (CAS 630-51-3) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: 2,2,3,3-tetramethylbutanedioic acid. InChIKey: CDPPYCZVWYZBJH-UHFFFAOYSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | 2,2,3,3-tetramethylbutanedioic acid |
| InChIKey | CDPPYCZVWYZBJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,2,3,3-Tetramethylsuccinic acid, Tetramethylsuccinic acid, 2,2,3,3-tetramethylbutanedioic acid, Tetramethylbutanedioic acid, Butanedioic acid, tetramethyl-, 2,2,3,3-Tetramethyl-succinic acid, Succinic acid, tetramethyl-, Maybridge1_002196, 2,2,3,3-Tetramethylbutane-1,4-dioic acid, NCIOpen2_001461