cas: 290825-52-4 — see every product listed under this CAS number, including other names
Dimethyl 2-(2-nitro-4-trifluoromethylphenyl)malonate, 95%, 95% (CAS 290825-52-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113X0R-250mg |
| cas | 290825-52-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 818.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]propanedioate (CAS 290825-52-4) is a chemical compound with the molecular formula C12H10F3NO6 and a molecular weight of 321.21 g/mol. IUPAC name: dimethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]propanedioate. InChIKey: MBAQGFLNQDHQCE-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO6 |
|---|---|
| Molecular weight | 321.21 g/mol |
| IUPAC name | dimethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]propanedioate |
| InChIKey | MBAQGFLNQDHQCE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)