CAS 1300730-68-0 is the registry number for Dimethyl 2-(4-nitro-2-trifluoromethylphenyl)malonate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Dimethyl 2-[4-nitro-2-(trifluoromethyl)phenyl]propanedioate (CAS 1300730-68-0) is a chemical compound with the molecular formula C12H10F3NO6 and a molecular weight of 321.21 g/mol. IUPAC name: dimethyl 2-[4-nitro-2-(trifluoromethyl)phenyl]propanedioate. InChIKey: UJDVQPIBEPTJNV-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO6 |
|---|---|
| Molecular weight | 321.21 g/mol |
| IUPAC name | dimethyl 2-[4-nitro-2-(trifluoromethyl)phenyl]propanedioate |
| InChIKey | UJDVQPIBEPTJNV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)[N+](=O)[O-])C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)