cas: 1632-19-5 — see every product listed under this CAS number, including other names
Dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate, 98%+(HPLC),RG, 98%+(HPLC),RG (CAS 1632-19-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TV7-100mg |
| cas | 1632-19-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 856.40 Pln |
| purity | 98%+(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
Dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate (CAS 1632-19-5) is a chemical compound with the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. IUPAC name: dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate. InChIKey: QCPBGHYMHYWRHG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO6 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | dimethyl 3,4-dihydroxy-1H-pyrrole-2,5-dicarboxylate |
| InChIKey | QCPBGHYMHYWRHG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(N1)C(=O)OC)O)O |
Computed by PubChem (NCBI)