Products 1093186-44-7

CAS 1093186-44-7 is the registry number for Dimethyl 4-hydroxy-5-oxo-2,5-dihydro-1h-pyrrole-2,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-2,3-dicarboxylate (CAS 1093186-44-7) is a chemical compound with the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. IUPAC name: dimethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-2,3-dicarboxylate. InChIKey: FMPGHFCUGMZZIF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO6
Molecular weight215.16 g/mol
IUPAC namedimethyl 4-hydroxy-5-oxo-1,2-dihydropyrrole-2,3-dicarboxylate
InChIKeyFMPGHFCUGMZZIF-UHFFFAOYSA-N
SMILESCOC(=O)C1C(=C(C(=O)N1)O)C(=O)OC

Computed by PubChem (NCBI)