CAS 15448-76-7 appears in our catalog under these names: Dimethyl bicyclo(2.2.1)heptane-1,4-dicarboxylate, Dimethyl bicyclo[2.2.1]heptane-1,4-dicarboxylate, 97%, 97%, Dimethyl bicyclo[2.2.1]heptane-1,4-dicarboxylate, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 25g, 25mg, 100mg, 250mg, 500mg, 1g, 5g.
Dimethyl bicyclo[2.2.1]heptane-1,4-dicarboxylate (CAS 15448-76-7) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: dimethyl bicyclo[2.2.1]heptane-1,4-dicarboxylate. InChIKey: UBGSPDWVUMFEAZ-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | dimethyl bicyclo[2.2.1]heptane-1,4-dicarboxylate |
| InChIKey | UBGSPDWVUMFEAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(C1)(CC2)C(=O)OC |
Computed by PubChem (NCBI)