Products 27259-79-6
CAS 27259-79-6 appears in our catalog under these names: Dimethyl spiro[3.3]heptane-2,6-dicarboxylate, 95%, (+)-Dimethyl spiro(3.3)heptane-2,6-dicarboxylate, 95%, DIMETHYL SPIRO(3·3)HEPTANE–2，6–DICARBOXYLATE, DIMETHYL SPIRO[3.3]HEPTANE-2,6-DICARBOXYLATE, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
Dimethyl spiro[3.3]heptane-2,6-dicarboxylate (CAS 27259-79-6) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: dimethyl spiro[3.3]heptane-2,6-dicarboxylate. InChIKey: WDSRXUBJASECTM-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | dimethyl spiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | WDSRXUBJASECTM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2(C1)CC(C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dimethyl spiro(3.3)heptane-2,6-dicarboxylate, Dimethyl Spiro[3.3]heptane-2,6-dicarboxylate, Spiro[3.3]heptane-2,6-dicarboxylic acid, 2,6-dimethyl ester, Spiro[3.3]heptane-2,6-dicarboxylic acid, dimethyl ester, Spiro[3.3]heptane-2,6-dicarboxylic acid, dimethyl ester, (+), orb3176246, DimethylSpiro[3.3]heptane-2,6-dicarboxylate, (+)-Dimethyl spiro[3.3]heptane-2,6-dicarboxylate