Products 37942-79-3
CAS 37942-79-3 appears in our catalog under these names: Spiro(3.3)heptane-2,6-dicarboxylic acid, 2,6-dimethyl ester, Dimethyl spiro[3.3]heptane-2,6-dicarboxylate, 97%, 97%, Dimethyl spiro[3.3]heptane-2,6-dicarboxylate, 98.0%, Dimethyl spiro[3.3]heptane-2,6-dicarboxylate, 97%. Offered by: Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1g, 0,5g, 2g, 5g, 100mg, 250mg, 10g, 25g.
Dimethyl spiro[3.3]heptane-2,6-dicarboxylate (CAS 37942-79-3) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: dimethyl spiro[3.3]heptane-2,6-dicarboxylate. InChIKey: WDSRXUBJASECTM-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | dimethyl spiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | WDSRXUBJASECTM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2(C1)CC(C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dimethyl spiro(3.3)heptane-2,6-dicarboxylate, Dimethyl Spiro[3.3]heptane-2,6-dicarboxylate, Spiro[3.3]heptane-2,6-dicarboxylic acid, 2,6-dimethyl ester, Spiro[3.3]heptane-2,6-dicarboxylic acid, dimethyl ester, Spiro[3.3]heptane-2,6-dicarboxylic acid, dimethyl ester, (+), orb3176246, DimethylSpiro[3.3]heptane-2,6-dicarboxylate, (+)-Dimethyl spiro[3.3]heptane-2,6-dicarboxylate