Dimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)phosphine oxide 95%
cas: 1394346-20-3 — see every product listed under this CAS number, including other names
Dimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)phosphine oxide 95% (CAS 1394346-20-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1151319-50mg |
| cas | 1394346-20-3 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 559.50 Pln | |
| Ambeed | 100mg | 915.50 Pln | |
| Ambeed | 250mg | 1755.44 Pln | |
| Ambeed | 1g | 4364.25 Pln | |
| Ambeed | 5g | 15099.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1151319 |
2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1394346-20-3) is a chemical compound with the molecular formula C14H22BO3P and a molecular weight of 280.11 g/mol. IUPAC name: 2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XFBGUSJMWBCZDC-UHFFFAOYSA-N.
| Molecular formula | C14H22BO3P |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XFBGUSJMWBCZDC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)P(=O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)phosphine oxide, 2-(4-dimethylphosphorylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[4-(Dimethylphosphoryl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, Dimethyl[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphine oxide, XFBGUSJMWBCZDC-UHFFFAOYSA-N, 4-(Dimethylphosphoryl)phenylboronic Acid Pinacol Ester, Dimethyl(4-(4455-Tetramethyl-132-Dioxaborolan-2-Yl)Phenyl)Phosphine Oxide