CAS 537-12-2 appears in our catalog under these names: Diperodon Hydrochloride, >95% (HPLC), Diperodon hydrochloride/ 99.59% (existing batch purity), Diperodon HCl, Diperodon HCl 99%, Diperodon (hydrochloride). Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 200mg, 500mg, 5mg, 10mM (in 1ml dmso), 50mg.
[2-(phenylcarbamoyloxy)-3-piperidin-1-ylpropyl] N-phenylcarbamate;hydrochloride (CAS 537-12-2) is a chemical compound with the molecular formula C22H28ClN3O4 and a molecular weight of 433.9 g/mol. IUPAC name: [2-(phenylcarbamoyloxy)-3-piperidin-1-ylpropyl] N-phenylcarbamate;hydrochloride. InChIKey: OWULVAZDMWJBLB-UHFFFAOYSA-N.
| Molecular formula | C22H28ClN3O4 |
|---|---|
| Molecular weight | 433.9 g/mol |
| IUPAC name | [2-(phenylcarbamoyloxy)-3-piperidin-1-ylpropyl] N-phenylcarbamate;hydrochloride |
| InChIKey | OWULVAZDMWJBLB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC(COC(=O)NC2=CC=CC=C2)OC(=O)NC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)