cas: 775-12-2 — see every product listed under this CAS number, including other names
Diphenylsilane, 98%, 98% (CAS 775-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PQ4-1g |
| cas | 775-12-2 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 410.00 Pln | |
| Chemat | 500g | 1872.00 Pln | |
| Chemat | 1kg | 2387.60 Pln | |
| Chemat | 5kg | 12278.40 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Diphenylsilane (CAS 775-12-2) is a chemical compound with the molecular formula C12H12Si and a molecular weight of 184.31 g/mol. IUPAC name: diphenylsilane. InChIKey: VDCSGNNYCFPWFK-UHFFFAOYSA-N.
| Molecular formula | C12H12Si |
|---|---|
| Molecular weight | 184.31 g/mol |
| IUPAC name | diphenylsilane |
| InChIKey | VDCSGNNYCFPWFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[SiH2]C2=CC=CC=C2 |
Computed by PubChem (NCBI)