CAS 17950-94-6 appears in our catalog under these names: Diphenyl(silane-d2), 97%, Diphenylsilane-D2, Diphenyl(silane-d2), DIPHENYLSILANE-D2, 97 ATOM % D. Offered by: Combi-blocks, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 10mg, 0,1g.
Dideuterio(diphenyl)silane (CAS 17950-94-6) is a chemical compound with the molecular formula C12H12Si and a molecular weight of 186.32 g/mol. IUPAC name: dideuterio(diphenyl)silane. InChIKey: VDCSGNNYCFPWFK-KLTYLHELSA-N.
| Molecular formula | C12H12Si |
|---|---|
| Molecular weight | 186.32 g/mol |
| IUPAC name | dideuterio(diphenyl)silane |
| InChIKey | VDCSGNNYCFPWFK-KLTYLHELSA-N |
| SMILES | [2H][Si]([2H])(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)