CAS 872363-17-2 appears in our catalog under these names: 6-Fluoro-2-[4-(2-pyridinyl)-3-butyn-1-yl]imidazo[1,2-a]pyridine, 98%, 98%, Dipraglurant/ 98.7% (existing batch purity), Dipraglurant, Dipraglurant 98%, Dipraglurant, 99.97%. Offered by: Chemat, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
6-fluoro-2-(4-pyridin-2-ylbut-3-ynyl)imidazo[1,2-a]pyridine (CAS 872363-17-2) is a chemical compound with the molecular formula C16H12FN3 and a molecular weight of 265.28 g/mol. IUPAC name: 6-fluoro-2-(4-pyridin-2-ylbut-3-ynyl)imidazo[1,2-a]pyridine. InChIKey: LZXMUJCJAWVHPZ-UHFFFAOYSA-N.
| Molecular formula | C16H12FN3 |
|---|---|
| Molecular weight | 265.28 g/mol |
| IUPAC name | 6-fluoro-2-(4-pyridin-2-ylbut-3-ynyl)imidazo[1,2-a]pyridine |
| InChIKey | LZXMUJCJAWVHPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C#CCCC2=CN3C=C(C=CC3=N2)F |
Computed by PubChem (NCBI)