cas: 131-15-7 — see every product listed under this CAS number, including other names
Disecoctyl Phthalate, ≥98%, ≥98% (CAS 131-15-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GRJ-5g |
| cas | 131-15-7 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 4456.40 Pln | |
| Chemat | 25g | 8728.40 Pln | |
| Chemat | 100g | 15818.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
Dioctan-2-yl benzene-1,2-dicarboxylate (CAS 131-15-7) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 390.6 g/mol. IUPAC name: dioctan-2-yl benzene-1,2-dicarboxylate. InChIKey: RLRMXWDXPLINPJ-UHFFFAOYSA-N.
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | dioctan-2-yl benzene-1,2-dicarboxylate |
| InChIKey | RLRMXWDXPLINPJ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)CCCCCC |
Computed by PubChem (NCBI)