cas: 1335210-23-5 — see every product listed under this CAS number, including other names
Dolutegravir intermediate-1 98% (CAS 1335210-23-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277021-250mg |
| cas | 1335210-23-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 375.94 Pln | |
| Ambeed | 100g | 826.50 Pln | |
| Ambeed | 500g | 3835.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277021 |
1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid (CAS 1335210-23-5) is a chemical compound with the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. IUPAC name: 1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid. InChIKey: XAXGEECGULRZGN-UHFFFAOYSA-N.
| Molecular formula | C13H17NO8 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | 1-(2,2-dimethoxyethyl)-5-methoxy-6-methoxycarbonyl-4-oxopyridine-3-carboxylic acid |
| InChIKey | XAXGEECGULRZGN-UHFFFAOYSA-N |
| SMILES | COC1=C(N(C=C(C1=O)C(=O)O)CC(OC)OC)C(=O)OC |
Computed by PubChem (NCBI)