CAS 13501-95-6 appears in our catalog under these names: 2,3,4,5-Tetra-o-acetyl-d-xylonitrile, 95%, 2,3,4,5-Tetra-O-acetyl-D-xylononitrile. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1000mg, 500mg, 2000mg, 5000mg.
[(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate (CAS 13501-95-6) is a chemical compound with the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. IUPAC name: [(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate. InChIKey: YHTPKBYAZJOQCI-YNEHKIRRSA-N.
| Molecular formula | C13H17NO8 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | [(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate |
| InChIKey | YHTPKBYAZJOQCI-YNEHKIRRSA-N |
| SMILES | CC(=O)OC[C@H]([C@@H]([C@H](C#N)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)