Products 170911-68-9
CAS 170911-68-9 appears in our catalog under these names: Donitriptan Hydrochloride, >95% (HPLC), Donitriptan hydrochloride/ 99.8% (existing batch purity), Donitriptan hydrochloride, Donitriptan hydrochloride, Donitriptan (hydrochloride). Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 2mg, 5mg, 25mg, 50mg, 200mg, 250mg.
4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]benzonitrile;hydrochloride (CAS 170911-68-9) is a chemical compound with the molecular formula C23H26ClN5O2 and a molecular weight of 439.9 g/mol. IUPAC name: 4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]benzonitrile;hydrochloride. InChIKey: ZXENQGQAPOYDOJ-UHFFFAOYSA-N.
| Molecular formula | C23H26ClN5O2 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | 4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]benzonitrile;hydrochloride |
| InChIKey | ZXENQGQAPOYDOJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)C#N)C(=O)COC3=CC4=C(C=C3)NC=C4CCN.Cl |
Computed by PubChem (NCBI)