cas: 1285572-51-1 — see every product listed under this CAS number, including other names
Dotinurad, 98%, 98% (CAS 1285572-51-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V709-50g |
| cas | 1285572-51-1 |
| size | 50g |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1528.40 Pln | |
| Chemat | 100g | 2637.20 Pln | |
| Chemat | 250g | 5219.60 Pln | |
| Chemat | 50mg | 318.80 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone (CAS 1285572-51-1) is a chemical compound with the molecular formula C14H9Cl2NO4S and a molecular weight of 358.2 g/mol. IUPAC name: (3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone. InChIKey: VOFLAIHEELWYGO-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO4S |
|---|---|
| Molecular weight | 358.2 g/mol |
| IUPAC name | (3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone |
| InChIKey | VOFLAIHEELWYGO-UHFFFAOYSA-N |
| SMILES | C1N(C2=CC=CC=C2S1(=O)=O)C(=O)C3=CC(=C(C(=C3)Cl)O)Cl |
Computed by PubChem (NCBI)