CAS 1285572-51-1 appears in our catalog under these names: Dotinurad, >95% (HPLC), Dotinurad, Dotinurad 99%, Dotinurad, 98%, 98%. Offered by: TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 0,5mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
(3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone (CAS 1285572-51-1) is a chemical compound with the molecular formula C14H9Cl2NO4S and a molecular weight of 358.2 g/mol. IUPAC name: (3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone. InChIKey: VOFLAIHEELWYGO-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO4S |
|---|---|
| Molecular weight | 358.2 g/mol |
| IUPAC name | (3,5-dichloro-4-hydroxyphenyl)-(1,1-dioxo-2H-1,3-benzothiazol-3-yl)methanone |
| InChIKey | VOFLAIHEELWYGO-UHFFFAOYSA-N |
| SMILES | C1N(C2=CC=CC=C2S1(=O)=O)C(=O)C3=CC(=C(C(=C3)Cl)O)Cl |
Computed by PubChem (NCBI)