CAS 2756099-59-7 appears in our catalog under these names: Dual FAAH/sEH-IN-1/ 99.89% (existing batch purity), Dual FAAH/sEH–IN–1, Dual FAAH/sEH-IN-1. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2-chlorophenyl)sulfonylpiperidine-4-carboxamide (CAS 2756099-59-7) is a chemical compound with the molecular formula C25H22ClN3O3S2 and a molecular weight of 512.0 g/mol. IUPAC name: N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2-chlorophenyl)sulfonylpiperidine-4-carboxamide. InChIKey: NVHVCPVLWHYRRB-UHFFFAOYSA-N.
| Molecular formula | C25H22ClN3O3S2 |
|---|---|
| Molecular weight | 512.0 g/mol |
| IUPAC name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2-chlorophenyl)sulfonylpiperidine-4-carboxamide |
| InChIKey | NVHVCPVLWHYRRB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)NC2=CC=C(C=C2)C3=NC4=CC=CC=C4S3)S(=O)(=O)C5=CC=CC=C5Cl |
Computed by PubChem (NCBI)