CAS 151213-86-4 appears in our catalog under these names: E-3620/ 98.88% (existing batch purity), E–3620, E-3620, E-3620, 98.88%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 10 mg, 250 mg, 100 mg, 10mM/1mL, 50 mg, 5 mg.
4-amino-5-chloro-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride (CAS 151213-86-4) is a chemical compound with the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.3 g/mol. IUPAC name: 4-amino-5-chloro-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride. InChIKey: GMHMNKHDLXRRGF-LZMJSSQSSA-N.
| Molecular formula | C20H27Cl2N3O2 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | 4-amino-5-chloro-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2-[(2S)-pent-3-yn-2-yl]oxybenzamide;hydrochloride |
| InChIKey | GMHMNKHDLXRRGF-LZMJSSQSSA-N |
| SMILES | CC#C[C@H](C)OC1=CC(=C(C=C1C(=O)NC2C[C@H]3CC[C@@H](C2)N3C)Cl)N.Cl |
Computed by PubChem (NCBI)