EAI045, 97%
cas: 1942114-09-1 — see every product listed under this CAS number, including other names
EAI045, 97% (CAS 1942114-09-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A105328-250mg |
| cas | 1942114-09-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2261.62 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 112.40 Pln | |
| Chemat | 10mg | 136.40 Pln | |
| Chemat | 25mg | 150.80 Pln | |
| Chemat | 50mg | 170.00 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Chemat | 5g | 2387.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide (CAS 1942114-09-1) is a chemical compound with the molecular formula C19H14FN3O3S and a molecular weight of 383.4 g/mol. IUPAC name: 2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide. InChIKey: YTUFHOKUFOQRDF-UHFFFAOYSA-N.
| Molecular formula | C19H14FN3O3S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| InChIKey | YTUFHOKUFOQRDF-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C(C3=C(C=CC(=C3)F)O)C(=O)NC4=NC=CS4 |
Computed by PubChem (NCBI)