CAS 1942114-09-1 appears in our catalog under these names: EAI045, EAI045/ 99.73% (existing batch purity), EAI045 97%, EAI045, 97%, 97%, EAI045, 99.06%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 50mg, 500mg, 1mg, 5mg, 250mg.
2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide (CAS 1942114-09-1) is a chemical compound with the molecular formula C19H14FN3O3S and a molecular weight of 383.4 g/mol. IUPAC name: 2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide. InChIKey: YTUFHOKUFOQRDF-UHFFFAOYSA-N.
| Molecular formula | C19H14FN3O3S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| InChIKey | YTUFHOKUFOQRDF-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C(C3=C(C=CC(=C3)F)O)C(=O)NC4=NC=CS4 |
Computed by PubChem (NCBI)