Products 229476-53-3
CAS 229476-53-3 appears in our catalog under these names: EBE-A22/ 99.88% (existing batch purity), EBE-A 22, EBE-A22, 98%, 98%, EBE-A22, 99.76%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-(3-bromophenyl)-6,7-dimethoxy-N-methylquinazolin-4-amine (CAS 229476-53-3) is a chemical compound with the molecular formula C17H16BrN3O2 and a molecular weight of 374.2 g/mol. IUPAC name: N-(3-bromophenyl)-6,7-dimethoxy-N-methylquinazolin-4-amine. InChIKey: IPWGDOZPSOZFOD-UHFFFAOYSA-N.
| Molecular formula | C17H16BrN3O2 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | N-(3-bromophenyl)-6,7-dimethoxy-N-methylquinazolin-4-amine |
| InChIKey | IPWGDOZPSOZFOD-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=CC=C1)Br)C2=NC=NC3=CC(=C(C=C32)OC)OC |
Computed by PubChem (NCBI)