CAS 879127-07-8 appears in our catalog under these names: Egfr inhibitor, 95%, EGFR-IN-12/ 99.15% (existing batch purity), EGFR Inhibitor, EGFR Inhibitor, EGFR Inhibitor 1PC X 1MG. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
N-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide (CAS 879127-07-8) is a chemical compound with the molecular formula C21H18F3N5O and a molecular weight of 413.4 g/mol. IUPAC name: N-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide. InChIKey: YOHYSYJDKVYCJI-UHFFFAOYSA-N.
| Molecular formula | C21H18F3N5O |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | N-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide |
| InChIKey | YOHYSYJDKVYCJI-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=CC=CC(=C2)NC3=NC=NC(=C3)NC4=CC=CC(=C4)C(F)(F)F |
Computed by PubChem (NCBI)