CAS 1418308-27-6 appears in our catalog under these names: EI1/ 99.98% (existing batch purity), EI1, EI1, 95%, EI1, 98.84%, 6-Cyano-N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-1-(pentan-3-yl)-1H-indole-4-carboxamide, 96%. Offered by: TargetMol, GLPBio, Thermo Scientific (Acros), Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
6-cyano-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-pentan-3-ylindole-4-carboxamide (CAS 1418308-27-6) is a chemical compound with the molecular formula C23H26N4O2 and a molecular weight of 390.5 g/mol. IUPAC name: 6-cyano-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-pentan-3-ylindole-4-carboxamide. InChIKey: PFHDWRIVDDIFRP-UHFFFAOYSA-N.
| Molecular formula | C23H26N4O2 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 6-cyano-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-pentan-3-ylindole-4-carboxamide |
| InChIKey | PFHDWRIVDDIFRP-UHFFFAOYSA-N |
| SMILES | CCC(CC)N1C=CC2=C(C=C(C=C21)C#N)C(=O)NCC3=C(C=C(NC3=O)C)C |
Computed by PubChem (NCBI)