CAS 1233948-61-2 appears in our catalog under these names: EL-102/ 99.34% (existing batch purity), EL–102, EL-102, EL-102, 99.44%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
N-[5-(5-cyanothiophen-3-yl)-2-methylphenyl]-4-methoxybenzenesulfonamide (CAS 1233948-61-2) is a chemical compound with the molecular formula C19H16N2O3S2 and a molecular weight of 384.5 g/mol. IUPAC name: N-[5-(5-cyanothiophen-3-yl)-2-methylphenyl]-4-methoxybenzenesulfonamide. InChIKey: STJKZARVVAISJM-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O3S2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | N-[5-(5-cyanothiophen-3-yl)-2-methylphenyl]-4-methoxybenzenesulfonamide |
| InChIKey | STJKZARVVAISJM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CSC(=C2)C#N)NS(=O)(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)