CAS 768370-75-8 appears in our catalog under these names: EMD-503982/ 99.12% (existing batch purity), EMD-503982. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 25 mg, 5 mg.
(2R,4R)-1-N-(4-chlorophenyl)-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide (CAS 768370-75-8) is a chemical compound with the molecular formula C22H23ClN4O5 and a molecular weight of 458.9 g/mol. IUPAC name: (2R,4R)-1-N-(4-chlorophenyl)-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide. InChIKey: DMYZJLOWGSRVKP-RTBURBONSA-N.
| Molecular formula | C22H23ClN4O5 |
|---|---|
| Molecular weight | 458.9 g/mol |
| IUPAC name | (2R,4R)-1-N-(4-chlorophenyl)-4-hydroxy-2-N-[4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide |
| InChIKey | DMYZJLOWGSRVKP-RTBURBONSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC(=O)[C@H]3C[C@H](CN3C(=O)NC4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)