CAS 147527-31-9 appears in our catalog under these names: EMD57033/ 99.72% (existing batch purity), (+)–EMD 57033, Myosin atpase activator, emd57003, (+)-EMD 57033, (+)-EMD 57033, 99.72%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2mg.
5-[1-(3,4-dimethoxybenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one (CAS 147527-31-9) is a chemical compound with the molecular formula C22H23N3O4S and a molecular weight of 425.5 g/mol. IUPAC name: 5-[1-(3,4-dimethoxybenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one. InChIKey: IZLRMTJLQCLMKF-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O4S |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 5-[1-(3,4-dimethoxybenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
| InChIKey | IZLRMTJLQCLMKF-UHFFFAOYSA-N |
| SMILES | CC1C(=NNC(=O)S1)C2=CC3=C(C=C2)N(CCC3)C(=O)C4=CC(=C(C=C4)OC)OC |
Computed by PubChem (NCBI)