CAS 1808714-73-9 appears in our catalog under these names: EN6/ 97.04% (existing batch purity), EN 6, EN6 98%, N-[4-Fluoro-3-[(1-oxo-2-propen-1-yl)amino]phenyl]-1-(2-fluorophenyl)-1H-pyrazole-4-carboxamide, 98%, 98%, EN6, 99.42%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1-(2-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide (CAS 1808714-73-9) is a chemical compound with the molecular formula C19H14F2N4O2 and a molecular weight of 368.3 g/mol. IUPAC name: 1-(2-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide. InChIKey: SUSXQEYPNDORDQ-UHFFFAOYSA-N.
| Molecular formula | C19H14F2N4O2 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide |
| InChIKey | SUSXQEYPNDORDQ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=C(C=CC(=C1)NC(=O)C2=CN(N=C2)C3=CC=CC=C3F)F |
Computed by PubChem (NCBI)