CAS 344457-87-0 appears in our catalog under these names: EO-1606/ 99.27% (existing batch purity), EO-1606, p38 MAPK-IN-5, 99.52%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
[2-chloro-4-(4-fluoro-2-methylanilino)phenyl]-(2-methylphenyl)methanone (CAS 344457-87-0) is a chemical compound with the molecular formula C21H17ClFNO and a molecular weight of 353.8 g/mol. IUPAC name: [2-chloro-4-(4-fluoro-2-methylanilino)phenyl]-(2-methylphenyl)methanone. InChIKey: QIBLVZMAUUVSMB-UHFFFAOYSA-N.
| Molecular formula | C21H17ClFNO |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | [2-chloro-4-(4-fluoro-2-methylanilino)phenyl]-(2-methylphenyl)methanone |
| InChIKey | QIBLVZMAUUVSMB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)C2=C(C=C(C=C2)NC3=C(C=C(C=C3)F)C)Cl |
Computed by PubChem (NCBI)