CAS 1415683-79-2 appears in our catalog under these names: ERG240/ 99.73% (existing batch purity), EGR240, Sodium 4-methyl-5-oxohexanoate, ERG240, 98.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 100 mg.
Sodium 4-methyl-5-oxohexanoate (CAS 1415683-79-2) is a chemical compound with the molecular formula C7H11NaO3 and a molecular weight of 166.15 g/mol. IUPAC name: sodium 4-methyl-5-oxohexanoate. InChIKey: QEQCTLAIARYMND-UHFFFAOYSA-M.
| Molecular formula | C7H11NaO3 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | sodium 4-methyl-5-oxohexanoate |
| InChIKey | QEQCTLAIARYMND-UHFFFAOYSA-M |
| SMILES | CC(CCC(=O)[O-])C(=O)C.[Na+] |
Computed by PubChem (NCBI)