CAS 2318792-30-0 appears in our catalog under these names: ERK5-IN-5/ 99.77% (existing batch purity), ERK5–IN–5, ERK5-IN-5 99%, ERK5-IN-5, 99.05%, (4-(1H-Pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydropyridin-1(2H)-yl)(4-chlorophenyl)methanone, 99%, 99%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(4-chlorophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone (CAS 2318792-30-0) is a chemical compound with the molecular formula C19H16ClN3O and a molecular weight of 337.8 g/mol. IUPAC name: (4-chlorophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone. InChIKey: NPYUZOWNGDUZMF-UHFFFAOYSA-N.
| Molecular formula | C19H16ClN3O |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | (4-chlorophenyl)-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| InChIKey | NPYUZOWNGDUZMF-UHFFFAOYSA-N |
| SMILES | C1CN(CC=C1C2=CNC3=C2C=CC=N3)C(=O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)