cas: 127192-72-7 — see every product listed under this CAS number, including other names
ETHANOL, 2-(4-[2,2':6',2''-TERPYRIDIN]-4'-YLPHENOXY)-, 95%, 95% (CAS 127192-72-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WQU-25mg |
| cas | 127192-72-7 |
| size | 25mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 1442.00 Pln | |
| Chemat | 50mg | 2406.80 Pln | |
| Chemat | 100mg | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethanol (CAS 127192-72-7) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethanol. InChIKey: ITTHDGHSDFMYOE-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethanol |
| InChIKey | ITTHDGHSDFMYOE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)OCCO |
Computed by PubChem (NCBI)