cas: 162246-77-7 — see every product listed under this CAS number, including other names
ETHYL 2-ACETOXY-2-(DIETHOXYPHOSPHORYL)ACETATE, 97% (CAS 162246-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306431-100MG |
| cas | 162246-77-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 500mg | 653.95 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 3340.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-acetyloxy-2-diethoxyphosphorylacetate (CAS 162246-77-7) is a chemical compound with the molecular formula C10H19O7P and a molecular weight of 282.23 g/mol. IUPAC name: ethyl 2-acetyloxy-2-diethoxyphosphorylacetate. InChIKey: QHQNXSICNKWLOC-UHFFFAOYSA-N.
| Molecular formula | C10H19O7P |
|---|---|
| Molecular weight | 282.23 g/mol |
| IUPAC name | ethyl 2-acetyloxy-2-diethoxyphosphorylacetate |
| InChIKey | QHQNXSICNKWLOC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(OC(=O)C)P(=O)(OCC)OCC |
Computed by PubChem (NCBI)