cas: 162246-77-7 — see every product listed under this CAS number, including other names
Ethyl 2-Acetoxy-2-(diethoxyphosphoryl)acetate 98% (CAS 162246-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756515-100mg |
| cas | 162246-77-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Ambeed | 5g | 3413.06 Pln | |
| Ambeed | 10g | 6094.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756515 |
Ethyl 2-acetyloxy-2-diethoxyphosphorylacetate (CAS 162246-77-7) is a chemical compound with the molecular formula C10H19O7P and a molecular weight of 282.23 g/mol. IUPAC name: ethyl 2-acetyloxy-2-diethoxyphosphorylacetate. InChIKey: QHQNXSICNKWLOC-UHFFFAOYSA-N.
| Molecular formula | C10H19O7P |
|---|---|
| Molecular weight | 282.23 g/mol |
| IUPAC name | ethyl 2-acetyloxy-2-diethoxyphosphorylacetate |
| InChIKey | QHQNXSICNKWLOC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(OC(=O)C)P(=O)(OCC)OCC |
Computed by PubChem (NCBI)