cas: 25909-66-4 — see every product listed under this CAS number, including other names
ETHYLENE GLYCOL BIS[4-(ETHOXYCARBONYL)PHENYL] ETHER, 95% (CAS 25909-66-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F814785-250MG |
| cas | 25909-66-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 627.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-[2-(4-ethoxycarbonylphenoxy)ethoxy]benzoate (CAS 25909-66-4) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: ethyl 4-[2-(4-ethoxycarbonylphenoxy)ethoxy]benzoate. InChIKey: XTHNYIOBLBKRMO-UHFFFAOYSA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | ethyl 4-[2-(4-ethoxycarbonylphenoxy)ethoxy]benzoate |
| InChIKey | XTHNYIOBLBKRMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)OCCOC2=CC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)