CAS 81065-76-1 appears in our catalog under these names: EUK 134, EUK-134/ 99.78% (existing batch purity), EUK-134 97%, EUK 134, 98%, 98%, EUK-134, 98.27%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 20mg, 10mM (in 1ml dmso), 50mg, 10mg, 25mg, 100mg, 200mg, 500mg.
Manganese(3+);2-methoxy-6-[2-[(3-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride (CAS 81065-76-1) is a chemical compound with the molecular formula C18H18ClMnN2O4 and a molecular weight of 416.7 g/mol. IUPAC name: manganese(3+);2-methoxy-6-[2-[(3-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride. InChIKey: YUZJJFWCXJDFOQ-UHFFFAOYSA-K.
| Molecular formula | C18H18ClMnN2O4 |
|---|---|
| Molecular weight | 416.7 g/mol |
| IUPAC name | manganese(3+);2-methoxy-6-[2-[(3-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride |
| InChIKey | YUZJJFWCXJDFOQ-UHFFFAOYSA-K |
| SMILES | COC1=CC=CC(=C1[O-])C=NCCN=CC2=C(C(=CC=C2)OC)[O-].[Cl-].[Mn+3] |
Computed by PubChem (NCBI)