CAS 2411759-92-5 appears in our catalog under these names: EZM0414 (SETD2–IN–1) TFA, EZM0414 TFA/ 96.2% (existing batch purity), SETD2-IN-1 TFA, EZM0414 (TFA), EZM0414 (TFA), 97.20%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 2mg, 10mM/1mL, 100 mg, 10 mg.
N-[(1R,3S)-3-(4-acetylpiperazin-1-yl)cyclohexyl]-4-fluoro-7-methyl-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid (CAS 2411759-92-5) is a chemical compound with the molecular formula C24H30F4N4O4 and a molecular weight of 514.5 g/mol. IUPAC name: N-[(1R,3S)-3-(4-acetylpiperazin-1-yl)cyclohexyl]-4-fluoro-7-methyl-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid. InChIKey: HASNOYOGMISGTP-PPPUBMIESA-N.
| Molecular formula | C24H30F4N4O4 |
|---|---|
| Molecular weight | 514.5 g/mol |
| IUPAC name | N-[(1R,3S)-3-(4-acetylpiperazin-1-yl)cyclohexyl]-4-fluoro-7-methyl-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid |
| InChIKey | HASNOYOGMISGTP-PPPUBMIESA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C=C(N2)C(=O)N[C@@H]3CCC[C@@H](C3)N4CCN(CC4)C(=O)C.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)